Compound Q&A

How is 4-[(Trifluoromethyl)sulfanyl]benzoic acid (CAS: 330-17-6) typically synthesized?

Answer

4-[(Trifluoromethyl)sulfanyl]benzoic acid
4-[(Trifluoromethyl)sulfanyl]benzoic acid is typically synthesized via the sulfonation of 4-bromobenzoic acid using trifluoromethanesulfonic anhydride. The reaction is carried out in the presence of a phase transfer catalyst such as tetrabutylammonium bromide to enhance the yield and selectivity. The process usually involves multiple steps and requires careful control of reaction conditions to achieve the desired product.

About

CAS No 330-17-6
English Name 4-[(Trifluoromethyl)sulfanyl]benzoic acid
Molecular Formula C8H5F3O2S
Molecular Weight 222.19 g/mol
SMILES C1=CC(=CC=C1C(=O)O)SC(F)(F)F
InChIKey UMOGQQWVQUQTQA-UHFFFAOYSA-N
Last Updated: 2025-10-13 17:50

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-[(Trifluoromethyl)sulfanyl]benzoic acid (CAS: 330-17-6)?

4-[(Trifluoromethyl)sulfanyl]benzoic acid is a white solid with a molecular weight of approximately ...

Compound Q&A

What industries use 4-[(Trifluoromethyl)sulfanyl]benzoic acid (CAS: 330-17-6)?

4-[(Trifluoromethyl)sulfanyl]benzoic acid is used in various industries. It is a key intermediate in...

Compound Q&A

What precautions should be taken when handling 4-[(Trifluoromethyl)sulfanyl]benzoic acid (CAS: 330-17-6)?

When handling 4-[(Trifluoromethyl)sulfanyl]benzoic acid, proper personal protective equipment (PPE) ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...