Compound Q&A

What precautions should be taken when handling Myricetin-3-galactoside (CAS: 15648-86-9)?

Answer

Myricetin-3-galactoside
When handling Myricetin-3-galactoside (CAS: 15648-86-9), it is important to wear appropriate personal protective equipment (PPE) such as gloves, safety goggles, and a lab coat. Handle the compound in a well-ventilated area or fume hood to minimize inhalation risks. Dispose of any waste according to local regulations and always refer to the Material Safety Data Sheet (MSDS) for specific handling instructions and emergency procedures.

About

CAS No 15648-86-9
English Name Myricetin-3-galactoside
Molecular Formula C21H20O13
Molecular Weight 480.38 g/mol
SMILES C1=C(C=C(C(=C1O)O)O)C2=C(C(=O)C3=C(C=C(C=C3O2)O)O)OC4C(C(C(C(O4)CO)O)O)O
InChIKey FOHXFLPXBUAOJM-OPAWWROQSA-N
Last Updated: 2025-10-13 17:50

Related Q&A

Compound Q&A

What are the physical and chemical properties of Myricetin-3-galactoside (CAS: 15648-86-9)?

Myricetin-3-galactoside (CAS: 15648-86-9) is a crystalline compound with a molecular weight of appro...

Compound Q&A

How is Myricetin-3-galactoside (CAS: 15648-86-9) typically synthesized?

Myricetin-3-galactoside (CAS: 15648-86-9) is typically synthesized via a glycosylation reaction betw...

Compound Q&A

What industries use Myricetin-3-galactoside (CAS: 15648-86-9)?

Myricetin-3-galactoside (CAS: 15648-86-9) is used in pharmaceutical industries for its potential ant...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...