Compound Q&A

What are the physical and chemical properties of Myricetin-3-galactoside (CAS: 15648-86-9)?

Answer

Myricetin-3-galactoside
Myricetin-3-galactoside (CAS: 15648-86-9) is a crystalline compound with a molecular weight of approximately 504.24 g/mol. It has a solubility of about 2 mg/mL in water and is poorly soluble in organic solvents. Chemically, it is less reactive compared to other flavonoids, showing moderate stability under normal conditions. It is sensitive to basic conditions and can undergo hydrolysis under certain pH conditions.

About

CAS No 15648-86-9
English Name Myricetin-3-galactoside
Molecular Formula C21H20O13
Molecular Weight 480.38 g/mol
SMILES C1=C(C=C(C(=C1O)O)O)C2=C(C(=O)C3=C(C=C(C=C3O2)O)O)OC4C(C(C(C(O4)CO)O)O)O
InChIKey FOHXFLPXBUAOJM-OPAWWROQSA-N
Last Updated: 2025-10-13 17:50

Related Q&A

Compound Q&A

How is Myricetin-3-galactoside (CAS: 15648-86-9) typically synthesized?

Myricetin-3-galactoside (CAS: 15648-86-9) is typically synthesized via a glycosylation reaction betw...

Compound Q&A

What industries use Myricetin-3-galactoside (CAS: 15648-86-9)?

Myricetin-3-galactoside (CAS: 15648-86-9) is used in pharmaceutical industries for its potential ant...

Compound Q&A

What precautions should be taken when handling Myricetin-3-galactoside (CAS: 15648-86-9)?

When handling Myricetin-3-galactoside (CAS: 15648-86-9), it is important to wear appropriate persona...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...