Compound Q&A

How is Mivacurium dichloride (CAS: 106861-44-3) typically synthesized?

Answer

Mivacurium dichloride
Mivacurium dichloride is synthesized via a multi-step process involving the reaction of a 1,4-diazabicyclo[2.2.2]octane derivative with a quaternary ammonium salt. The key steps include nucleophilic substitution and chloride elimination, yielding the desired product with high selectivity and good yield.

About

English Name Mivacurium dichloride
Molecular Formula C58H80Cl2N2O14
Molecular Weight 1100.2 g/mol
SMILES C[N+]1(CCC2=CC(=C(C=C2C1CC3=CC(=C(C(=C3)OC)OC)OC)OC)OC)CCCOC(=O)CCC=CCCC(=O)OCCC[N+]4(CCC5=CC(=C(C=C5C4CC6=CC(=C(C(=C6)OC)OC)OC)OC)OC)C.[Cl-].[Cl-]
InChIKey WMSYWJSZGVOIJW-ONUALHDOSA-L
Last Updated: 2025-10-13 17:50

Related Q&A

Compound Q&A

What are the physical and chemical properties of Mivacurium dichloride (CAS: 106861-44-3)?

Mivacurium dichloride is a crystalline compound with a molecular weight of approximately 347.34 g/mo...

Compound Q&A

What industries use Mivacurium dichloride (CAS: 106861-44-3)?

Mivacurium dichloride is primarily used in the pharmaceutical industry as a muscle relaxant during s...

Compound Q&A

What precautions should be taken when handling Mivacurium dichloride (CAS: 106861-44-3)?

Proper personal protective equipment (PPE) such as gloves, goggles, and a lab coat should be worn wh...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...