Compound Q&A

What are the physical and chemical properties of Mivacurium dichloride (CAS: 106861-44-3)?

Answer

Mivacurium dichloride
Mivacurium dichloride is a crystalline compound with a molecular weight of approximately 347.34 g/mol. It is sparingly soluble in water and highly reactive under basic conditions. The compound is stable under normal storage conditions but may degrade in the presence of moisture and light.

About

English Name Mivacurium dichloride
Molecular Formula C58H80Cl2N2O14
Molecular Weight 1100.2 g/mol
SMILES C[N+]1(CCC2=CC(=C(C=C2C1CC3=CC(=C(C(=C3)OC)OC)OC)OC)OC)CCCOC(=O)CCC=CCCC(=O)OCCC[N+]4(CCC5=CC(=C(C=C5C4CC6=CC(=C(C(=C6)OC)OC)OC)OC)OC)C.[Cl-].[Cl-]
InChIKey WMSYWJSZGVOIJW-ONUALHDOSA-L
Last Updated: 2025-10-13 17:50

Related Q&A

Compound Q&A

How is Mivacurium dichloride (CAS: 106861-44-3) typically synthesized?

Mivacurium dichloride is synthesized via a multi-step process involving the reaction of a 1,4-diazab...

Compound Q&A

What industries use Mivacurium dichloride (CAS: 106861-44-3)?

Mivacurium dichloride is primarily used in the pharmaceutical industry as a muscle relaxant during s...

Compound Q&A

What precautions should be taken when handling Mivacurium dichloride (CAS: 106861-44-3)?

Proper personal protective equipment (PPE) such as gloves, goggles, and a lab coat should be worn wh...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...