Compound Q&A

How is Oleic diethanolamide (CAS: 93-83-4) typically synthesized?

Answer

Oleic diethanolamide
Oleic diethanolamide is typically synthesized through the reaction of oleic acid with diethanolamine. The process involves heating oleic acid with an excess of diethanolamine in the presence of an acid catalyst to promote the esterification and amidation reactions. The product is isolated by washing and drying, yielding a white solid with a high degree of purity.

About

CAS No 93-83-4
English Name Oleic diethanolamide
Molecular Formula C22H43NO3
Molecular Weight 369.59 g/mol
SMILES CCCCCCCCC=CCCCCCCCC(=O)N(CCO)CCO
InChIKey LPMBTLLQQJBUOO-KTKRTIGZSA-N
Last Updated: 2025-10-13 17:50

Related Q&A

Compound Q&A

What are the physical and chemical properties of Oleic diethanolamide (CAS: 93-83-4)?

Oleic diethanolamide (CAS: 93-83-4) is a white to off-white solid with a molecular weight of approxi...

Compound Q&A

What industries use Oleic diethanolamide (CAS: 93-83-4)?

Oleic diethanolamide (CAS: 93-83-4) is widely used in the food, pharmaceutical, and cosmetic industr...

Compound Q&A

What precautions should be taken when handling Oleic diethanolamide (CAS: 93-83-4)?

When handling Oleic diethanolamide (CAS: 93-83-4), proper personal protective equipment (PPE) such a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...