Compound Q&A

What are the physical and chemical properties of Oleic diethanolamide (CAS: 93-83-4)?

Answer

Oleic diethanolamide
Oleic diethanolamide (CAS: 93-83-4) is a white to off-white solid with a molecular weight of approximately 372.45 g/mol. It has a high solubility in water and low solubility in organic solvents. Chemically, it is reactive with strong acids and bases, making it suitable for use in surfactant applications. It has a pKa of around 8.5, indicating its basic nature.

About

CAS No 93-83-4
English Name Oleic diethanolamide
Molecular Formula C22H43NO3
Molecular Weight 369.59 g/mol
SMILES CCCCCCCCC=CCCCCCCCC(=O)N(CCO)CCO
InChIKey LPMBTLLQQJBUOO-KTKRTIGZSA-N
Last Updated: 2025-10-13 17:50

Related Q&A

Compound Q&A

How is Oleic diethanolamide (CAS: 93-83-4) typically synthesized?

Oleic diethanolamide is typically synthesized through the reaction of oleic acid with diethanolamine...

Compound Q&A

What industries use Oleic diethanolamide (CAS: 93-83-4)?

Oleic diethanolamide (CAS: 93-83-4) is widely used in the food, pharmaceutical, and cosmetic industr...

Compound Q&A

What precautions should be taken when handling Oleic diethanolamide (CAS: 93-83-4)?

When handling Oleic diethanolamide (CAS: 93-83-4), proper personal protective equipment (PPE) such a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...