Compound Q&A

What industries use 1-(Bromomethyl)-3,5-bis(trifluoromethyl)benzene (CAS: 32247-96-4)?

Answer

1-(Bromomethyl)-3,5-bis(trifluoromethyl)benzene
1-(Bromomethyl)-3,5-bis(trifluoromethyl)benzene is primarily used in the pharmaceutical and polymer industries. It serves as a precursor for the synthesis of various medicinally active compounds and is also utilized in the development of polymers with specific properties. Its application in sensors and semiconductors is also being explored due to its unique chemical structure.

About

CAS No 32247-96-4
English Name 1-(Bromomethyl)-3,5-bis(trifluoromethyl)benzene
Molecular Formula C9H5BrF6
Molecular Weight 307.03099999999995 g/mol
SMILES C1=C(C=C(C=C1C(F)(F)F)C(F)(F)F)CBr
InChIKey ATLQGZVLWOURFU-UHFFFAOYSA-N
Last Updated: 2025-10-13 17:50

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-(Bromomethyl)-3,5-bis(trifluoromethyl)benzene (CAS: 32247-96-4)?

1-(Bromomethyl)-3,5-bis(trifluoromethyl)benzene is a crystalline compound with a high molecular weig...

Compound Q&A

How is 1-(Bromomethyl)-3,5-bis(trifluoromethyl)benzene (CAS: 32247-96-4) typically synthesized?

1-(Bromomethyl)-3,5-bis(trifluoromethyl)benzene is usually synthesized via the reaction of 3,5-bis(t...

Compound Q&A

What precautions should be taken when handling 1-(Bromomethyl)-3,5-bis(trifluoromethyl)benzene (CAS: 32247-96-4)?

When handling 1-(Bromomethyl)-3,5-bis(trifluoromethyl)benzene, it is essential to wear appropriate p...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...