Compound Q&A

What industries use 2-Methyl-2-propanyl 1-piperazinecarboxylate acetate (1:1) (CAS: 143238-38-4)?

Answer

2-Methyl-2-propanyl 1-piperazinecarboxylate acetate (1:1)
2-Methyl-2-propanyl 1-piperazinecarboxylate acetate (1:1) is primarily used in the pharmaceutical industry for the synthesis of certain drugs. It is also utilized in the polymer industry for the production of advanced polymers with improved properties. Additionally, it has applications in the sensor industry for the development of chemical sensors and in the semiconductor industry for its use in surface modification and cleaning processes.

About

English Name 2-Methyl-2-propanyl 1-piperazinecarboxylate acetate (1:1)
Molecular Formula C11H22N2O4
Molecular Weight 246.31 g/mol
SMILES CC(=O)O.CC(C)(C)OC(=O)N1CCNCC1
InChIKey VRYAIUMHCRSUDX-UHFFFAOYSA-N
Last Updated: 2025-10-13 17:50

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl 1-piperazinecarboxylate acetate (1:1) (CAS: 143238-38-4)?

2-Methyl-2-propanyl 1-piperazinecarboxylate acetate (1:1) is a colorless to slightly yellowish liqui...

Compound Q&A

How is 2-Methyl-2-propanyl 1-piperazinecarboxylate acetate (1:1) (CAS: 143238-38-4) typically synthesized?

2-Methyl-2-propanyl 1-piperazinecarboxylate acetate (1:1) is synthesized by the esterification of 2-...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-propanyl 1-piperazinecarboxylate acetate (1:1) (CAS: 143238-38-4)?

When handling 2-Methyl-2-propanyl 1-piperazinecarboxylate acetate (1:1), wear appropriate personal p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...