Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl 1-piperazinecarboxylate acetate (1:1) (CAS: 143238-38-4)?

Answer

2-Methyl-2-propanyl 1-piperazinecarboxylate acetate (1:1)
2-Methyl-2-propanyl 1-piperazinecarboxylate acetate (1:1) is a colorless to slightly yellowish liquid with a molecular weight of approximately 262.38 g/mol. It has a low solubility in water (less than 1 g/L at 20°C) but is soluble in organic solvents like ethanol and acetone. The compound is moderately reactive, showing some hydrolytic stability but is susceptible to base-catalyzed degradation. It crystallizes in the monoclinic system.

About

English Name 2-Methyl-2-propanyl 1-piperazinecarboxylate acetate (1:1)
Molecular Formula C11H22N2O4
Molecular Weight 246.31 g/mol
SMILES CC(=O)O.CC(C)(C)OC(=O)N1CCNCC1
InChIKey VRYAIUMHCRSUDX-UHFFFAOYSA-N
Last Updated: 2025-10-13 17:50

Related Q&A

Compound Q&A

How is 2-Methyl-2-propanyl 1-piperazinecarboxylate acetate (1:1) (CAS: 143238-38-4) typically synthesized?

2-Methyl-2-propanyl 1-piperazinecarboxylate acetate (1:1) is synthesized by the esterification of 2-...

Compound Q&A

What industries use 2-Methyl-2-propanyl 1-piperazinecarboxylate acetate (1:1) (CAS: 143238-38-4)?

2-Methyl-2-propanyl 1-piperazinecarboxylate acetate (1:1) is primarily used in the pharmaceutical in...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-propanyl 1-piperazinecarboxylate acetate (1:1) (CAS: 143238-38-4)?

When handling 2-Methyl-2-propanyl 1-piperazinecarboxylate acetate (1:1), wear appropriate personal p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...