Compound Q&A

What are the physical and chemical properties of 7-[2-(4-Morpholinyl)ethoxy]-4-[2-(2-pyridinyl)-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazol-3-yl]quinoline (CAS: 700874-71-1)?

Answer

7-[2-(4-Morpholinyl)ethoxy]-4-[2-(2-pyridinyl)-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazol-3-yl]quinoline
The compound has a solid crystalline form with a molecular weight of approximately 542.73 g/mol. It is slightly soluble in organic solvents like methanol and acetonitrile. Chemically, it is stable in neutral conditions but can be sensitive to strong acids and bases. It shows moderate reactivity towards electrophilic aromatic substitution and nucleophilic addition reactions.

About

English Name 7-[2-(4-Morpholinyl)ethoxy]-4-[2-(2-pyridinyl)-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazol-3-yl]quinoline
Molecular Formula C26H27N5O2
Molecular Weight 441.54 g/mol
SMILES C1CC2=C(C(=NN2C1)C3=CC=CC=N3)C4=C5C=CC(=CC5=NC=C4)OCCN6CCOCC6
InChIKey IHLVSLOZUHKNMQ-UHFFFAOYSA-N
Last Updated: 2025-10-13 17:50

Related Q&A

Compound Q&A

How is 7-[2-(4-Morpholinyl)ethoxy]-4-[2-(2-pyridinyl)-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazol-3-yl]quinoline (CAS: 700874-71-1) typically synthesized?

It is synthesized through a multi-step process involving the reaction of 4-quinolinecarboxaldehyde w...

Compound Q&A

What industries use 7-[2-(4-Morpholinyl)ethoxy]-4-[2-(2-pyridinyl)-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazol-3-yl]quinoline (CAS: 700874-71-1)?

This compound is primarily used in the pharmaceutical industry for the development of new drugs due ...

Compound Q&A

What precautions should be taken when handling 7-[2-(4-Morpholinyl)ethoxy]-4-[2-(2-pyridinyl)-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazol-3-yl]quinoline (CAS: 700874-71-1)?

When handling this compound, it is essential to wear appropriate personal protective equipment (PPE)...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...