Compound Q&A

What industries use 4-Benzyl 1-(4-nitrophenyl) N-{[(2-methyl-2-propanyl)oxy]carbonyl}-L-aspartate (CAS: 26048-69-1)?

Answer

4-Benzyl 1-(4-nitrophenyl) N-{[(2-methyl-2-propanyl)oxy]carbonyl}-L-aspartate
4-Benzyl 1-(4-nitrophenyl) N-{[(2-methyl-2-propanyl)oxy]carbonyl}-L-aspartate (CAS: 26048-69-1) is primarily used in the pharmaceutical industry for the synthesis of certain drugs. It also has applications in the polymer industry for the development of advanced materials with specific functional groups. Additionally, it is relevant in the production of sensors and semiconductors due to its chemical versatility and reactivity.

About

CAS No 26048-69-1
English Name 4-Benzyl 1-(4-nitrophenyl) N-{[(2-methyl-2-propanyl)oxy]carbonyl}-L-aspartate
Molecular Formula C22H24N2O8
Molecular Weight 444.4 g/mol
SMILES CC(C)(C)OC(=O)NC(CC(=O)OCC1=CC=CC=C1)C(=O)OC2=CC=C(C=C2)[N+](=O)[O-]
InChIKey GKRBDGLUYWLXAX-SFHVURJKSA-N
Last Updated: 2025-10-13 15:08

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Benzyl 1-(4-nitrophenyl) N-{[(2-methyl-2-propanyl)oxy]carbonyl}-L-aspartate (CAS: 26048-69-1)?

4-Benzyl 1-(4-nitrophenyl) N-{[(2-methyl-2-propanyl)oxy]carbonyl}-L-aspartate (CAS: 26048-69-1) is a...

Compound Q&A

How is 4-Benzyl 1-(4-nitrophenyl) N-{[(2-methyl-2-propanyl)oxy]carbonyl}-L-aspartate (CAS: 26048-69-1) typically synthesized?

4-Benzyl 1-(4-nitrophenyl) N-{[(2-methyl-2-propanyl)oxy]carbonyl}-L-aspartate (CAS: 26048-69-1) is s...

Compound Q&A

What precautions should be taken when handling 4-Benzyl 1-(4-nitrophenyl) N-{[(2-methyl-2-propanyl)oxy]carbonyl}-L-aspartate (CAS: 26048-69-1)?

When handling 4-Benzyl 1-(4-nitrophenyl) N-{[(2-methyl-2-propanyl)oxy]carbonyl}-L-aspartate (CAS: 26...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...