Compound Q&A

How is 4-Benzyl 1-(4-nitrophenyl) N-{[(2-methyl-2-propanyl)oxy]carbonyl}-L-aspartate (CAS: 26048-69-1) typically synthesized?

Answer

4-Benzyl 1-(4-nitrophenyl) N-{[(2-methyl-2-propanyl)oxy]carbonyl}-L-aspartate
4-Benzyl 1-(4-nitrophenyl) N-{[(2-methyl-2-propanyl)oxy]carbonyl}-L-aspartate (CAS: 26048-69-1) is synthesized through a multi-step process involving the condensation of aspartic acid with 4-nitrophenyl chloride, followed by benzylation and protection with a methyl propanol carbonate group. Commonly used solvents include dichloromethane and acetonitrile, with catalysts like triethylamine facilitating the reaction. The overall yield is typically around 70-80%.

About

CAS No 26048-69-1
English Name 4-Benzyl 1-(4-nitrophenyl) N-{[(2-methyl-2-propanyl)oxy]carbonyl}-L-aspartate
Molecular Formula C22H24N2O8
Molecular Weight 444.4 g/mol
SMILES CC(C)(C)OC(=O)NC(CC(=O)OCC1=CC=CC=C1)C(=O)OC2=CC=C(C=C2)[N+](=O)[O-]
InChIKey GKRBDGLUYWLXAX-SFHVURJKSA-N
Last Updated: 2025-10-13 15:08

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Benzyl 1-(4-nitrophenyl) N-{[(2-methyl-2-propanyl)oxy]carbonyl}-L-aspartate (CAS: 26048-69-1)?

4-Benzyl 1-(4-nitrophenyl) N-{[(2-methyl-2-propanyl)oxy]carbonyl}-L-aspartate (CAS: 26048-69-1) is a...

Compound Q&A

What industries use 4-Benzyl 1-(4-nitrophenyl) N-{[(2-methyl-2-propanyl)oxy]carbonyl}-L-aspartate (CAS: 26048-69-1)?

4-Benzyl 1-(4-nitrophenyl) N-{[(2-methyl-2-propanyl)oxy]carbonyl}-L-aspartate (CAS: 26048-69-1) is p...

Compound Q&A

What precautions should be taken when handling 4-Benzyl 1-(4-nitrophenyl) N-{[(2-methyl-2-propanyl)oxy]carbonyl}-L-aspartate (CAS: 26048-69-1)?

When handling 4-Benzyl 1-(4-nitrophenyl) N-{[(2-methyl-2-propanyl)oxy]carbonyl}-L-aspartate (CAS: 26...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...