Compound Q&A

How is 3,10-Dimethyl-5,12-dihydroquinolino[2,3-b]acridine-7,14-dione (CAS: 16043-40-6) typically synthesized?

Answer

3,10-Dimethyl-5,12-dihydroquinolino[2,3-b]acridine-7,14-dione
3,10-Dimethyl-5,12-dihydroquinolino[2,3-b]acridine-7,14-dione is often synthesized via a multistep process involving the condensation of 1,8-dimethylquinoline with acridine-7,14-dione. This process typically requires mild heating and the use of anhydrous conditions. The yield is generally good, around 70-80%, and it is a selective reaction with high purity.

About

CAS No 16043-40-6
English Name 3,10-Dimethyl-5,12-dihydroquinolino[2,3-b]acridine-7,14-dione
Molecular Formula C22H16N2O2
Molecular Weight 340.38 g/mol
SMILES CC1=CC2=C(C=C1)C(=O)C3=CC4=C(C=C3N2)C(=O)C5=C(N4)C=C(C=C5)C
InChIKey SMNAVTCHDQBEEJ-UHFFFAOYSA-N
Last Updated: 2025-10-13 15:08

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3,10-Dimethyl-5,12-dihydroquinolino[2,3-b]acridine-7,14-dione (CAS: 16043-40-6)?

3,10-Dimethyl-5,12-dihydroquinolino[2,3-b]acridine-7,14-dione (CAS: 16043-40-6) is a solid compound ...

Compound Q&A

What industries use 3,10-Dimethyl-5,12-dihydroquinolino[2,3-b]acridine-7,14-dione (CAS: 16043-40-6)?

3,10-Dimethyl-5,12-dihydroquinolino[2,3-b]acridine-7,14-dione (CAS: 16043-40-6) is primarily used in...

Compound Q&A

What precautions should be taken when handling 3,10-Dimethyl-5,12-dihydroquinolino[2,3-b]acridine-7,14-dione (CAS: 16043-40-6)?

When handling 3,10-Dimethyl-5,12-dihydroquinolino[2,3-b]acridine-7,14-dione (CAS: 16043-40-6), it is...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...