Compound Q&A

What are the physical and chemical properties of 3,10-Dimethyl-5,12-dihydroquinolino[2,3-b]acridine-7,14-dione (CAS: 16043-40-6)?

Answer

3,10-Dimethyl-5,12-dihydroquinolino[2,3-b]acridine-7,14-dione
3,10-Dimethyl-5,12-dihydroquinolino[2,3-b]acridine-7,14-dione (CAS: 16043-40-6) is a solid compound with a melting point of approximately 350°C. Its molecular weight is around 348.33 g/mol. This compound is sparingly soluble in common organic solvents such as ethanol and acetone. It is stable under normal conditions but may react with strong reducing agents. It has acidic and basic properties due to the presence of the quinoline and acridine moieties.

About

CAS No 16043-40-6
English Name 3,10-Dimethyl-5,12-dihydroquinolino[2,3-b]acridine-7,14-dione
Molecular Formula C22H16N2O2
Molecular Weight 340.38 g/mol
SMILES CC1=CC2=C(C=C1)C(=O)C3=CC4=C(C=C3N2)C(=O)C5=C(N4)C=C(C=C5)C
InChIKey SMNAVTCHDQBEEJ-UHFFFAOYSA-N
Last Updated: 2025-10-13 15:08

Related Q&A

Compound Q&A

How is 3,10-Dimethyl-5,12-dihydroquinolino[2,3-b]acridine-7,14-dione (CAS: 16043-40-6) typically synthesized?

3,10-Dimethyl-5,12-dihydroquinolino[2,3-b]acridine-7,14-dione is often synthesized via a multistep p...

Compound Q&A

What industries use 3,10-Dimethyl-5,12-dihydroquinolino[2,3-b]acridine-7,14-dione (CAS: 16043-40-6)?

3,10-Dimethyl-5,12-dihydroquinolino[2,3-b]acridine-7,14-dione (CAS: 16043-40-6) is primarily used in...

Compound Q&A

What precautions should be taken when handling 3,10-Dimethyl-5,12-dihydroquinolino[2,3-b]acridine-7,14-dione (CAS: 16043-40-6)?

When handling 3,10-Dimethyl-5,12-dihydroquinolino[2,3-b]acridine-7,14-dione (CAS: 16043-40-6), it is...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...