Compound Q&A

How is Osthenol (CAS: 484-14-0) typically synthesized?

Answer

Osthenol
Osthenol (CAS: 484-14-0) is typically synthesized via a condensation reaction of a suitable aldehyde and anisole in the presence of a strong acid catalyst such as concentrated sulfuric acid. The reaction yields a mixture of isomers, with the desired product being isolated by fractional distillation. The process is highly selective and provides good yields.

About

CAS No 484-14-0
English Name Osthenol
Molecular Formula C14H14O3
Molecular Weight 230.26 g/mol
SMILES CC(=CCC1=C(C=CC2=C1OC(=O)C=C2)O)C
InChIKey RAKJVIPCCGXHHS-UHFFFAOYSA-N
Last Updated: 2025-10-13 15:08

Related Q&A

Compound Q&A

What are the physical and chemical properties of Osthenol (CAS: 484-14-0)?

Osthenol (CAS: 484-14-0) is a colorless to pale yellow liquid. It has a molecular weight of approxim...

Compound Q&A

What industries use Osthenol (CAS: 484-14-0)?

Osthenol (CAS: 484-14-0) is primarily used in the pharmaceutical industry for the synthesis of vario...

Compound Q&A

What precautions should be taken when handling Osthenol (CAS: 484-14-0)?

When handling Osthenol (CAS: 484-14-0), safety goggles, gloves, and appropriate personal protective ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...