Compound Q&A

What are the physical and chemical properties of Osthenol (CAS: 484-14-0)?

Answer

Osthenol
Osthenol (CAS: 484-14-0) is a colorless to pale yellow liquid. It has a molecular weight of approximately 142.2 g/mol and a boiling point of 132°C. It is slightly soluble in water but miscible with most organic solvents. Osthenol is relatively chemically stable but can react with strong oxidizing agents. It exhibits moderate reactivity with alcohols and is used in organic synthesis and as a reagent.

About

CAS No 484-14-0
English Name Osthenol
Molecular Formula C14H14O3
Molecular Weight 230.26 g/mol
SMILES CC(=CCC1=C(C=CC2=C1OC(=O)C=C2)O)C
InChIKey RAKJVIPCCGXHHS-UHFFFAOYSA-N
Last Updated: 2025-10-13 15:08

Related Q&A

Compound Q&A

How is Osthenol (CAS: 484-14-0) typically synthesized?

Osthenol (CAS: 484-14-0) is typically synthesized via a condensation reaction of a suitable aldehyde...

Compound Q&A

What industries use Osthenol (CAS: 484-14-0)?

Osthenol (CAS: 484-14-0) is primarily used in the pharmaceutical industry for the synthesis of vario...

Compound Q&A

What precautions should be taken when handling Osthenol (CAS: 484-14-0)?

When handling Osthenol (CAS: 484-14-0), safety goggles, gloves, and appropriate personal protective ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...