Compound Q&A

How is (2R)-2-(4-Isobutylphenyl)propanoic acid (CAS: 51146-57-7) typically synthesized?

Answer

(2R)-2-(4-Isobutylphenyl)propanoic acid
(2R)-2-(4-Isobutylphenyl)propanoic acid is synthesized via a multi-step process, usually involving the protection of the carboxylic acid group, followed by substitution reactions. Common methods include Wittig reactions or Grignard reagents, with high selectivity and moderate yield. Specific catalysts and reagents are chosen based on the reaction conditions and desired product purity.

About

CAS No 51146-57-7
English Name (2R)-2-(4-Isobutylphenyl)propanoic acid
Molecular Formula C13H18O2
Molecular Weight 206.28 g/mol
SMILES CC(C)Cc1ccc(cc1)[C@@H](C)C(=O)O
InChIKey HEFNNWSXXWATRW-SNVBAGLBSA-N
Last Updated: 2025-10-13 15:08

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2R)-2-(4-Isobutylphenyl)propanoic acid (CAS: 51146-57-7)?

(2R)-2-(4-Isobutylphenyl)propanoic acid has a crystalline form and a molecular weight of approximate...

Compound Q&A

What industries use (2R)-2-(4-Isobutylphenyl)propanoic acid (CAS: 51146-57-7)?

(2R)-2-(4-Isobutylphenyl)propanoic acid is used in the pharmaceutical industry for the synthesis of ...

Compound Q&A

What precautions should be taken when handling (2R)-2-(4-Isobutylphenyl)propanoic acid (CAS: 51146-57-7)?

When handling (2R)-2-(4-Isobutylphenyl)propanoic acid, it is essential to wear appropriate personal ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...