Compound Q&A

What are the physical and chemical properties of (2R)-2-(4-Isobutylphenyl)propanoic acid (CAS: 51146-57-7)?

Answer

(2R)-2-(4-Isobutylphenyl)propanoic acid
(2R)-2-(4-Isobutylphenyl)propanoic acid has a crystalline form and a molecular weight of approximately 222.32 g/mol. It has a low solubility in water but is soluble in organic solvents like ethanol. The compound is moderately reactive, particularly towards nucleophilic substitution reactions. Its melting point is around 58-60°C.

About

CAS No 51146-57-7
English Name (2R)-2-(4-Isobutylphenyl)propanoic acid
Molecular Formula C13H18O2
Molecular Weight 206.28 g/mol
SMILES CC(C)Cc1ccc(cc1)[C@@H](C)C(=O)O
InChIKey HEFNNWSXXWATRW-SNVBAGLBSA-N
Last Updated: 2025-10-13 15:08

Related Q&A

Compound Q&A

How is (2R)-2-(4-Isobutylphenyl)propanoic acid (CAS: 51146-57-7) typically synthesized?

(2R)-2-(4-Isobutylphenyl)propanoic acid is synthesized via a multi-step process, usually involving t...

Compound Q&A

What industries use (2R)-2-(4-Isobutylphenyl)propanoic acid (CAS: 51146-57-7)?

(2R)-2-(4-Isobutylphenyl)propanoic acid is used in the pharmaceutical industry for the synthesis of ...

Compound Q&A

What precautions should be taken when handling (2R)-2-(4-Isobutylphenyl)propanoic acid (CAS: 51146-57-7)?

When handling (2R)-2-(4-Isobutylphenyl)propanoic acid, it is essential to wear appropriate personal ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...