Compound Q&A

What industries use (R)-1-benzylpiperidin-3-ol (CAS: 91599-81-4)?

Answer

(R)-1-benzylpiperidin-3-ol
(R)-1-benzylpiperidin-3-ol (CAS: 91599-81-4) is used in the pharmaceutical industry for the synthesis of drug candidates. It also finds applications in polymer chemistry for modifying polymer properties and in sensor technology for specific chemical detection. Its use in semiconductor manufacturing is less common but possible, depending on its functional groups.

About

CAS No 91599-81-4
English Name (R)-1-benzylpiperidin-3-ol
Molecular Formula C12H17NO
Molecular Weight 191.27 g/mol
SMILES C1CC(CN(C1)CC2=CC=CC=C2)O
InChIKey UTTCOAGPVHRUFO-GFCCVEGCSA-N
Last Updated: 2025-10-13 15:08

Related Q&A

Compound Q&A

What are the physical and chemical properties of (R)-1-benzylpiperidin-3-ol (CAS: 91599-81-4)?

(R)-1-benzylpiperidin-3-ol (CAS: 91599-81-4) has a crystalline form with a molecular weight of appro...

Compound Q&A

How is (R)-1-benzylpiperidin-3-ol (CAS: 91599-81-4) typically synthesized?

(R)-1-benzylpiperidin-3-ol (CAS: 91599-81-4) can be synthesized via several routes, including the Wi...

Compound Q&A

What precautions should be taken when handling (R)-1-benzylpiperidin-3-ol (CAS: 91599-81-4)?

When handling (R)-1-benzylpiperidin-3-ol (CAS: 91599-81-4), it is advisable to wear appropriate pers...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...