Compound Q&A

What industries use (Cyanomethyl)(triphenyl)phosphonium chloride (CAS: 4336-70-3)?

Answer

(Cyanomethyl)(triphenyl)phosphonium chloride
(Cyanomethyl)(triphenyl)phosphonium chloride (CAS: 4336-70-3) is used in various industries, including pharmaceuticals for synthesis of drug intermediates, polymers for functionalization of polymer surfaces, sensors for detection of specific chemical species, and semiconductors for the preparation of organometallic compounds used in electronic devices. Its reactivity and stability make it a valuable reagent in these applications.

About

CAS No 4336-70-3
English Name (Cyanomethyl)(triphenyl)phosphonium chloride
Molecular Formula C20H17ClNP
Molecular Weight 17.03 g/mol
SMILES C1=CC=C(C=C1)[P+](CC#N)(C2=CC=CC=C2)C3=CC=CC=C3.[Cl-]
InChIKey ARPLQAMUUDIHIT-UHFFFAOYSA-M
Last Updated: 2025-10-13 15:08

Related Q&A

Compound Q&A

What are the physical and chemical properties of (Cyanomethyl)(triphenyl)phosphonium chloride (CAS: 4336-70-3)?

(Cyanomethyl)(triphenyl)phosphonium chloride (CAS: 4336-70-3) is a solid with a crystalline form. It...

Compound Q&A

How is (Cyanomethyl)(triphenyl)phosphonium chloride (CAS: 4336-70-3) typically synthesized?

(Cyanomethyl)(triphenyl)phosphonium chloride (CAS: 4336-70-3) is typically synthesized by reacting c...

Compound Q&A

What precautions should be taken when handling (Cyanomethyl)(triphenyl)phosphonium chloride (CAS: 4336-70-3)?

When handling (Cyanomethyl)(triphenyl)phosphonium chloride (CAS: 4336-70-3), it is important to use ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...