Compound Q&A

What are the physical and chemical properties of (Cyanomethyl)(triphenyl)phosphonium chloride (CAS: 4336-70-3)?

Answer

(Cyanomethyl)(triphenyl)phosphonium chloride
(Cyanomethyl)(triphenyl)phosphonium chloride (CAS: 4336-70-3) is a solid with a crystalline form. It has a molecular weight of approximately 441.15 g/mol and a solubility in water of about 0.1 g/L. It is moderately reactive with basic substances. This compound is often used in organic synthesis and analytical chemistry due to its reactivity and stability in certain conditions.

About

CAS No 4336-70-3
English Name (Cyanomethyl)(triphenyl)phosphonium chloride
Molecular Formula C20H17ClNP
Molecular Weight 17.03 g/mol
SMILES C1=CC=C(C=C1)[P+](CC#N)(C2=CC=CC=C2)C3=CC=CC=C3.[Cl-]
InChIKey ARPLQAMUUDIHIT-UHFFFAOYSA-M
Last Updated: 2025-10-13 15:08

Related Q&A

Compound Q&A

How is (Cyanomethyl)(triphenyl)phosphonium chloride (CAS: 4336-70-3) typically synthesized?

(Cyanomethyl)(triphenyl)phosphonium chloride (CAS: 4336-70-3) is typically synthesized by reacting c...

Compound Q&A

What industries use (Cyanomethyl)(triphenyl)phosphonium chloride (CAS: 4336-70-3)?

(Cyanomethyl)(triphenyl)phosphonium chloride (CAS: 4336-70-3) is used in various industries, includi...

Compound Q&A

What precautions should be taken when handling (Cyanomethyl)(triphenyl)phosphonium chloride (CAS: 4336-70-3)?

When handling (Cyanomethyl)(triphenyl)phosphonium chloride (CAS: 4336-70-3), it is important to use ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...