Compound Q&A

What industries use Dimethyl 5-bromoisophthalate (CAS: 51760-21-5)?

Answer

Dimethyl 5-bromoisophthalate
Dimethyl 5-bromoisophthalate (CAS: 51760-21-5) is primarily used in the pharmaceutical and polymer industries. It serves as a precursor in the synthesis of various pharmaceutical intermediates and plays a role in the development of advanced polymer materials. Additionally, it is utilized in the production of sensors and semiconductors where its chemical properties are leveraged.

About

CAS No 51760-21-5
English Name Dimethyl 5-bromoisophthalate
Molecular Formula C10H9BrO4
Molecular Weight 273.08 g/mol
SMILES COC(=O)C1=CC(=CC(=C1)Br)C(=O)OC
InChIKey QUJINGKSNJNXEB-UHFFFAOYSA-N
Last Updated: 2025-10-13 15:08

Related Q&A

Compound Q&A

What are the physical and chemical properties of Dimethyl 5-bromoisophthalate (CAS: 51760-21-5)?

Dimethyl 5-bromoisophthalate (CAS: 51760-21-5) is a crystalline compound with a molecular weight of ...

Compound Q&A

How is Dimethyl 5-bromoisophthalate (CAS: 51760-21-5) typically synthesized?

Dimethyl 5-bromoisophthalate (CAS: 51760-21-5) can be synthesized through the bromination of isophth...

Compound Q&A

What precautions should be taken when handling Dimethyl 5-bromoisophthalate (CAS: 51760-21-5)?

When handling Dimethyl 5-bromoisophthalate (CAS: 51760-21-5), it is important to wear appropriate pe...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...