Compound Q&A

What are the physical and chemical properties of 2,4-Dichlorothieno[2,3-d]pyrimidine (CAS: 18740-39-1)?

Answer

2,4-Dichlorothieno[2,3-d]pyrimidine
2,4-Dichlorothieno[2,3-d]pyrimidine is a crystalline solid with a molecular weight of approximately 219.03 g/mol. It has a low solubility in water but is more soluble in organic solvents such as ethanol and acetone. Chemically, it is relatively unreactive under normal conditions but can undergo substitution reactions under certain conditions. It is stable under normal storage conditions but should be handled with care, especially when exposed to strong reducing agents.

About

CAS No 18740-39-1
English Name 2,4-Dichlorothieno[2,3-d]pyrimidine
Molecular Formula C6H2Cl2N2S
Molecular Weight 205.07 g/mol
SMILES C1=CSC2=C1C(=NC(=N2)Cl)Cl
InChIKey HRXNGIQKOWQHCX-UHFFFAOYSA-N
Last Updated: 2025-10-13 15:08

Related Q&A

Compound Q&A

How is 2,4-Dichlorothieno[2,3-d]pyrimidine (CAS: 18740-39-1) typically synthesized?

2,4-Dichlorothieno[2,3-d]pyrimidine can be synthesized via the condensation of 2,4-dichlorothiophene...

Compound Q&A

What industries use 2,4-Dichlorothieno[2,3-d]pyrimidine (CAS: 18740-39-1)?

2,4-Dichlorothieno[2,3-d]pyrimidine is primarily used in the pharmaceutical industry as an intermedi...

Compound Q&A

What precautions should be taken when handling 2,4-Dichlorothieno[2,3-d]pyrimidine (CAS: 18740-39-1)?

When handling 2,4-Dichlorothieno[2,3-d]pyrimidine, ensure safety gloves, goggles, and a lab coat are...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...