Compound Q&A

How is 3-Methoxy-O-methyltyrosine (CAS: 32161-30-1) typically synthesized?

Answer

3-Methoxy-O-methyltyrosine
3-Methoxy-O-methyltyrosine can be synthesized via a series of reactions starting from tyrosine. The key steps include methylation of the hydroxyl group and subsequent esterification of the phenolic hydroxyl group. Common reagents used include methanol and methanol sodium, with sodium hydroxide as a catalyst. The synthetic route ensures high yield and selectivity, making it suitable for commercial-scale production.

About

CAS No 32161-30-1
English Name 3-Methoxy-O-methyltyrosine
Molecular Formula C11H15NO4
Molecular Weight 225.24 g/mol
SMILES COC1=C(C=C(C=C1)CC(C(=O)O)N)OC
InChIKey VWTFNYVAFGYEKI-QMMMGPOBSA-N
Last Updated: 2025-10-13 12:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-Methoxy-O-methyltyrosine (CAS: 32161-30-1)?

3-Methoxy-O-methyltyrosine is a white crystalline compound with a molecular weight of approximately ...

Compound Q&A

What industries use 3-Methoxy-O-methyltyrosine (CAS: 32161-30-1)?

3-Methoxy-O-methyltyrosine is primarily used in the pharmaceutical industry for the synthesis of var...

Compound Q&A

What precautions should be taken when handling 3-Methoxy-O-methyltyrosine (CAS: 32161-30-1)?

When handling 3-Methoxy-O-methyltyrosine, appropriate personal protective equipment (PPE) such as gl...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...