Compound Q&A

What are the physical and chemical properties of 3-Methoxy-O-methyltyrosine (CAS: 32161-30-1)?

Answer

3-Methoxy-O-methyltyrosine
3-Methoxy-O-methyltyrosine is a white crystalline compound with a molecular weight of approximately 250.21 g/mol. It is slightly soluble in water and has good solubility in organic solvents like ethanol and acetone. The compound is relatively stable under normal conditions but can undergo hydrolysis in basic conditions. It exhibits moderate reactivity in chemical synthesis and is susceptible to oxidation.

About

CAS No 32161-30-1
English Name 3-Methoxy-O-methyltyrosine
Molecular Formula C11H15NO4
Molecular Weight 225.24 g/mol
SMILES COC1=C(C=C(C=C1)CC(C(=O)O)N)OC
InChIKey VWTFNYVAFGYEKI-QMMMGPOBSA-N
Last Updated: 2025-10-13 12:55

Related Q&A

Compound Q&A

How is 3-Methoxy-O-methyltyrosine (CAS: 32161-30-1) typically synthesized?

3-Methoxy-O-methyltyrosine can be synthesized via a series of reactions starting from tyrosine. The ...

Compound Q&A

What industries use 3-Methoxy-O-methyltyrosine (CAS: 32161-30-1)?

3-Methoxy-O-methyltyrosine is primarily used in the pharmaceutical industry for the synthesis of var...

Compound Q&A

What precautions should be taken when handling 3-Methoxy-O-methyltyrosine (CAS: 32161-30-1)?

When handling 3-Methoxy-O-methyltyrosine, appropriate personal protective equipment (PPE) such as gl...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...