Compound Q&A

How is Ethyl N-[(mesitylsulfonyl)oxy]ethanimidate (CAS: 38202-27-6) typically synthesized?

Answer

Ethyl N-[(mesitylsulfonyl)oxy]ethanimidate
Ethyl N-[(mesitylsulfonyl)oxy]ethanimidate (CAS: 38202-27-6) is typically synthesized by the reaction of mesityl oxide with ethyl ethanimidate. The process involves the formation of the mesitylsulfonyl group attached to the oxygen atom of the ethanimidic moiety. The reaction is catalyzed by acid and proceeds under mild conditions, yielding a high yield of the desired product.

About

CAS No 38202-27-6
English Name Ethyl N-[(mesitylsulfonyl)oxy]ethanimidate
Molecular Formula C13H19NO4S
Molecular Weight 285.37 g/mol
SMILES CCOC(=NOS(=O)(=O)C1=C(C=C(C=C1C)C)C)C
InChIKey KQCBSWBQAXTILK-UHFFFAOYSA-N
Last Updated: 2025-10-13 12:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ethyl N-[(mesitylsulfonyl)oxy]ethanimidate (CAS: 38202-27-6)?

Ethyl N-[(mesitylsulfonyl)oxy]ethanimidate (CAS: 38202-27-6) is a colorless liquid with a molecular ...

Compound Q&A

What industries use Ethyl N-[(mesitylsulfonyl)oxy]ethanimidate (CAS: 38202-27-6)?

Ethyl N-[(mesitylsulfonyl)oxy]ethanimidate (CAS: 38202-27-6) is primarily used in the pharmaceutical...

Compound Q&A

What precautions should be taken when handling Ethyl N-[(mesitylsulfonyl)oxy]ethanimidate (CAS: 38202-27-6)?

When handling Ethyl N-[(mesitylsulfonyl)oxy]ethanimidate (CAS: 38202-27-6), ensure that proper perso...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...