Compound Q&A

What are the physical and chemical properties of Ethyl N-[(mesitylsulfonyl)oxy]ethanimidate (CAS: 38202-27-6)?

Answer

Ethyl N-[(mesitylsulfonyl)oxy]ethanimidate
Ethyl N-[(mesitylsulfonyl)oxy]ethanimidate (CAS: 38202-27-6) is a colorless liquid with a molecular weight of approximately 288.43 g/mol. It has a melting point of -40°C and a boiling point of 130°C. This compound is slightly soluble in water but miscible with most organic solvents. It exhibits good reactivity towards nucleophiles and is commonly used as a leaving group in organic synthesis.

About

CAS No 38202-27-6
English Name Ethyl N-[(mesitylsulfonyl)oxy]ethanimidate
Molecular Formula C13H19NO4S
Molecular Weight 285.37 g/mol
SMILES CCOC(=NOS(=O)(=O)C1=C(C=C(C=C1C)C)C)C
InChIKey KQCBSWBQAXTILK-UHFFFAOYSA-N
Last Updated: 2025-10-13 12:55

Related Q&A

Compound Q&A

How is Ethyl N-[(mesitylsulfonyl)oxy]ethanimidate (CAS: 38202-27-6) typically synthesized?

Ethyl N-[(mesitylsulfonyl)oxy]ethanimidate (CAS: 38202-27-6) is typically synthesized by the reactio...

Compound Q&A

What industries use Ethyl N-[(mesitylsulfonyl)oxy]ethanimidate (CAS: 38202-27-6)?

Ethyl N-[(mesitylsulfonyl)oxy]ethanimidate (CAS: 38202-27-6) is primarily used in the pharmaceutical...

Compound Q&A

What precautions should be taken when handling Ethyl N-[(mesitylsulfonyl)oxy]ethanimidate (CAS: 38202-27-6)?

When handling Ethyl N-[(mesitylsulfonyl)oxy]ethanimidate (CAS: 38202-27-6), ensure that proper perso...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...