Compound Q&A

How is Obatoclax Mesylate (CAS: 803712-79-0) typically synthesized?

Answer

Obatoclax Mesylate
Obatoclax mesylate is typically synthesized through a multi-step process involving the installation of a mesylate group onto a specific amine. The synthesis involves the use of reagents like mesyl chloride and requires careful control of pH and temperature. The overall yield is moderate, and the reaction is selective under the given conditions.

About

English Name Obatoclax Mesylate
Molecular Formula C21H23N3O4S
Molecular Weight 413.5 g/mol
SMILES CC1=CC(=C(N1)C=C2C(=CC(=C3C=C4C=CC=CC4=N3)N2)OC)C.CS(=O)(=O)O
InChIKey ZFKXDVMHNXPEIY-PEZBNFGJSA-N
Last Updated: 2025-10-13 12:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of Obatoclax Mesylate (CAS: 803712-79-0)?

Obatoclax mesylate is a crystalline compound with a molecular weight of approximately 540.71 g/mol. ...

Compound Q&A

What industries use Obatoclax Mesylate (CAS: 803712-79-0)?

Obatoclax mesylate is primarily used in the pharmaceutical industry for its potential as an anticanc...

Compound Q&A

What precautions should be taken when handling Obatoclax Mesylate (CAS: 803712-79-0)?

When handling obatoclax mesylate, it is essential to wear appropriate personal protective equipment ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...