Compound Q&A

What are the physical and chemical properties of Obatoclax Mesylate (CAS: 803712-79-0)?

Answer

Obatoclax Mesylate
Obatoclax mesylate is a crystalline compound with a molecular weight of approximately 540.71 g/mol. It has low water solubility and is slightly soluble in organic solvents like DMSO. It is chemically reactive under certain conditions, particularly with bases and oxidizing agents. It is stable under normal storage conditions but requires protection from light.

About

English Name Obatoclax Mesylate
Molecular Formula C21H23N3O4S
Molecular Weight 413.5 g/mol
SMILES CC1=CC(=C(N1)C=C2C(=CC(=C3C=C4C=CC=CC4=N3)N2)OC)C.CS(=O)(=O)O
InChIKey ZFKXDVMHNXPEIY-PEZBNFGJSA-N
Last Updated: 2025-10-13 12:55

Related Q&A

Compound Q&A

How is Obatoclax Mesylate (CAS: 803712-79-0) typically synthesized?

Obatoclax mesylate is typically synthesized through a multi-step process involving the installation ...

Compound Q&A

What industries use Obatoclax Mesylate (CAS: 803712-79-0)?

Obatoclax mesylate is primarily used in the pharmaceutical industry for its potential as an anticanc...

Compound Q&A

What precautions should be taken when handling Obatoclax Mesylate (CAS: 803712-79-0)?

When handling obatoclax mesylate, it is essential to wear appropriate personal protective equipment ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...