Compound Q&A

What precautions should be taken when handling Tribenzylsilane (CAS: 1747-92-8)?

Answer

Tribenzylsilane
When handling Tribenzylsilane (CAS: 1747-92-8), it is essential to use appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Work should be conducted in a well-ventilated area or fume hood to minimize inhalation risks. Spills should be managed carefully using absorbent materials, and the spilled area should be flushed with water. Always refer to the safety data sheet (SDS) for detailed hazardous properties and emergency procedures.

About

CAS No 1747-92-8
English Name Tribenzylsilane
Molecular Formula C21H22Si
Molecular Weight 302.49 g/mol
SMILES C1=CC=C(C=C1)C[Si](CC2=CC=CC=C2)CC3=CC=CC=C3
InChIKey CLBRRQXSGPYXBX-UHFFFAOYSA-N
Last Updated: 2025-10-13 12:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of Tribenzylsilane (CAS: 1747-92-8)?

Tribenzylsilane (CAS: 1747-92-8) is a colorless liquid with a molecular weight of approximately 272....

Compound Q&A

How is Tribenzylsilane (CAS: 1747-92-8) typically synthesized?

Tribenzylsilane (CAS: 1747-92-8) is typically synthesized by reacting benzene with silicon tetrachlo...

Compound Q&A

What industries use Tribenzylsilane (CAS: 1747-92-8)?

Tribenzylsilane (CAS: 1747-92-8) finds applications in various industries, including pharmaceuticals...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...