Compound Q&A

What industries use Tribenzylsilane (CAS: 1747-92-8)?

Answer

Tribenzylsilane
Tribenzylsilane (CAS: 1747-92-8) finds applications in various industries, including pharmaceuticals, where it is used as a precursor for synthesis of organic compounds and intermediates. In the polymer industry, it serves as a monomer for preparing specialized polymers. It is also utilized in sensor technology and semiconductor fabrication due to its reactive properties and ability to form stable silicon-based compounds.

About

CAS No 1747-92-8
English Name Tribenzylsilane
Molecular Formula C21H22Si
Molecular Weight 302.49 g/mol
SMILES C1=CC=C(C=C1)C[Si](CC2=CC=CC=C2)CC3=CC=CC=C3
InChIKey CLBRRQXSGPYXBX-UHFFFAOYSA-N
Last Updated: 2025-10-13 12:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of Tribenzylsilane (CAS: 1747-92-8)?

Tribenzylsilane (CAS: 1747-92-8) is a colorless liquid with a molecular weight of approximately 272....

Compound Q&A

How is Tribenzylsilane (CAS: 1747-92-8) typically synthesized?

Tribenzylsilane (CAS: 1747-92-8) is typically synthesized by reacting benzene with silicon tetrachlo...

Compound Q&A

What precautions should be taken when handling Tribenzylsilane (CAS: 1747-92-8)?

When handling Tribenzylsilane (CAS: 1747-92-8), it is essential to use appropriate personal protecti...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...