Compound Q&A

What industries use 1-[Fluoro(1-pyrrolidinyl)methylene]pyrrolidinium hexafluorophosphate (CAS: 164298-25-3)?

Answer

1-[Fluoro(1-pyrrolidinyl)methylene]pyrrolidinium hexafluorophosphate
1-[Fluoro(1-pyrrolidinyl)methylene]pyrrolidinium hexafluorophosphate is primarily used in the pharmaceutical and polymer industries. It is also applied in the development of sensors and semiconductors due to its unique reactivity and solubility properties. Its use in organic synthesis makes it a valuable reagent in academic and industrial settings.

About

English Name 1-[Fluoro(1-pyrrolidinyl)methylene]pyrrolidinium hexafluorophosphate
Molecular Formula C9H16F7N2P
Molecular Weight 316.2 g/mol
SMILES C1CCN(C1)C(=[N+]2CCCC2)F.F[P-](F)(F)(F)(F)F
InChIKey MNJUGQKOHJQOCK-UHFFFAOYSA-N
Last Updated: 2025-10-13 12:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-[Fluoro(1-pyrrolidinyl)methylene]pyrrolidinium hexafluorophosphate (CAS: 164298-25-3)?

1-[Fluoro(1-pyrrolidinyl)methylene]pyrrolidinium hexafluorophosphate is a crystalline compound with ...

Compound Q&A

How is 1-[Fluoro(1-pyrrolidinyl)methylene]pyrrolidinium hexafluorophosphate (CAS: 164298-25-3) typically synthesized?

1-[Fluoro(1-pyrrolidinyl)methylene]pyrrolidinium hexafluorophosphate is synthesized through the reac...

Compound Q&A

What precautions should be taken when handling 1-[Fluoro(1-pyrrolidinyl)methylene]pyrrolidinium hexafluorophosphate (CAS: 164298-25-3)?

When handling 1-[Fluoro(1-pyrrolidinyl)methylene]pyrrolidinium hexafluorophosphate, it is essential ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...