Compound Q&A

What are the physical and chemical properties of 1-[Fluoro(1-pyrrolidinyl)methylene]pyrrolidinium hexafluorophosphate (CAS: 164298-25-3)?

Answer

1-[Fluoro(1-pyrrolidinyl)methylene]pyrrolidinium hexafluorophosphate
1-[Fluoro(1-pyrrolidinyl)methylene]pyrrolidinium hexafluorophosphate is a crystalline compound with a high molecular weight. It is soluble in polar solvents such as water and ethanol. This compound is known for its high reactivity, particularly in nucleophilic substitution reactions. It has a high melting point and is often used in organic synthesis and functional group transformations.

About

English Name 1-[Fluoro(1-pyrrolidinyl)methylene]pyrrolidinium hexafluorophosphate
Molecular Formula C9H16F7N2P
Molecular Weight 316.2 g/mol
SMILES C1CCN(C1)C(=[N+]2CCCC2)F.F[P-](F)(F)(F)(F)F
InChIKey MNJUGQKOHJQOCK-UHFFFAOYSA-N
Last Updated: 2025-10-13 12:55

Related Q&A

Compound Q&A

How is 1-[Fluoro(1-pyrrolidinyl)methylene]pyrrolidinium hexafluorophosphate (CAS: 164298-25-3) typically synthesized?

1-[Fluoro(1-pyrrolidinyl)methylene]pyrrolidinium hexafluorophosphate is synthesized through the reac...

Compound Q&A

What industries use 1-[Fluoro(1-pyrrolidinyl)methylene]pyrrolidinium hexafluorophosphate (CAS: 164298-25-3)?

1-[Fluoro(1-pyrrolidinyl)methylene]pyrrolidinium hexafluorophosphate is primarily used in the pharma...

Compound Q&A

What precautions should be taken when handling 1-[Fluoro(1-pyrrolidinyl)methylene]pyrrolidinium hexafluorophosphate (CAS: 164298-25-3)?

When handling 1-[Fluoro(1-pyrrolidinyl)methylene]pyrrolidinium hexafluorophosphate, it is essential ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...