Compound Q&A

What industries use 3-(4-((3-Phenoxybenzyl)amino)phenyl)propanoic acid (CAS: 885101-89-3)?

Answer

3-(4-((3-Phenoxybenzyl)amino)phenyl)propanoic acid
3-(4-((3-Phenoxybenzyl)amino)phenyl)propanoic acid (CAS: 885101-89-3) is used in the pharmaceutical industry for the development of certain drug candidates. It is also utilized in the polymer industry as a monomer for the synthesis of advanced polymers. Additionally, this compound has potential applications in the sensor and semiconductor industries due to its chemical reactivity and structural complexity.

About

English Name 3-(4-((3-Phenoxybenzyl)amino)phenyl)propanoic acid
Molecular Formula C22H21NO3
Molecular Weight 347.41 g/mol
SMILES C1=CC=C(C=C1)OC2=CC=CC(=C2)CNC3=CC=C(C=C3)CCC(=O)O
InChIKey DGENZVKCTGIDRZ-UHFFFAOYSA-N
Last Updated: 2025-10-13 12:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-(4-((3-Phenoxybenzyl)amino)phenyl)propanoic acid (CAS: 885101-89-3)?

3-(4-((3-Phenoxybenzyl)amino)phenyl)propanoic acid (CAS: 885101-89-3) is a solid crystalline compoun...

Compound Q&A

How is 3-(4-((3-Phenoxybenzyl)amino)phenyl)propanoic acid (CAS: 885101-89-3) typically synthesized?

3-(4-((3-Phenoxybenzyl)amino)phenyl)propanoic acid (CAS: 885101-89-3) is typically synthesized throu...

Compound Q&A

What precautions should be taken when handling 3-(4-((3-Phenoxybenzyl)amino)phenyl)propanoic acid (CAS: 885101-89-3)?

When handling 3-(4-((3-Phenoxybenzyl)amino)phenyl)propanoic acid (CAS: 885101-89-3), it is important...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...