Compound Q&A

What are the physical and chemical properties of 3-(4-((3-Phenoxybenzyl)amino)phenyl)propanoic acid (CAS: 885101-89-3)?

Answer

3-(4-((3-Phenoxybenzyl)amino)phenyl)propanoic acid
3-(4-((3-Phenoxybenzyl)amino)phenyl)propanoic acid (CAS: 885101-89-3) is a solid crystalline compound with a molecular weight of approximately 376.37 g/mol. It has a melting point of around 180-182°C. The compound is sparingly soluble in water and more soluble in organic solvents like ethanol and acetone. It is moderately reactive, especially under acidic or basic conditions, and may undergo hydrolysis or rearrangement. It is stable under normal storage conditions but should be kept away from strong oxidizers and reducing agents.

About

English Name 3-(4-((3-Phenoxybenzyl)amino)phenyl)propanoic acid
Molecular Formula C22H21NO3
Molecular Weight 347.41 g/mol
SMILES C1=CC=C(C=C1)OC2=CC=CC(=C2)CNC3=CC=C(C=C3)CCC(=O)O
InChIKey DGENZVKCTGIDRZ-UHFFFAOYSA-N
Last Updated: 2025-10-13 12:55

Related Q&A

Compound Q&A

How is 3-(4-((3-Phenoxybenzyl)amino)phenyl)propanoic acid (CAS: 885101-89-3) typically synthesized?

3-(4-((3-Phenoxybenzyl)amino)phenyl)propanoic acid (CAS: 885101-89-3) is typically synthesized throu...

Compound Q&A

What industries use 3-(4-((3-Phenoxybenzyl)amino)phenyl)propanoic acid (CAS: 885101-89-3)?

3-(4-((3-Phenoxybenzyl)amino)phenyl)propanoic acid (CAS: 885101-89-3) is used in the pharmaceutical ...

Compound Q&A

What precautions should be taken when handling 3-(4-((3-Phenoxybenzyl)amino)phenyl)propanoic acid (CAS: 885101-89-3)?

When handling 3-(4-((3-Phenoxybenzyl)amino)phenyl)propanoic acid (CAS: 885101-89-3), it is important...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...