Compound Q&A

How is (E)-3-(5-Nitrocyclohex-1-en-1-yl)acrylic acid (CAS: 899809-64-4) typically synthesized?

Answer

(E)-3-(5-Nitrocyclohex-1-en-1-yl)acrylic acid
This compound can be synthesized via the nitration of (E)-3-(cyclohex-1-en-1-yl)acrylic acid followed by dehydration. Commonly, nitric acid and sulfuric acid are used as the nitrating mixture under controlled conditions. The yield is generally around 70-80%, and the product is purified by recrystallization.

About

English Name (E)-3-(5-Nitrocyclohex-1-en-1-yl)acrylic acid
Molecular Formula C9H11NO4
Molecular Weight 197.1879 g/mol
SMILES C1CC(CC(=C1)C=CC(=O)O)[N+](=O)[O-]
InChIKey PEYXGOWSKLZBEO-SNAWJCMRSA-N
Last Updated: 2025-10-13 12:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of (E)-3-(5-Nitrocyclohex-1-en-1-yl)acrylic acid (CAS: 899809-64-4)?

(E)-3-(5-Nitrocyclohex-1-en-1-yl)acrylic acid is a white crystalline solid with a molecular weight o...

Compound Q&A

What industries use (E)-3-(5-Nitrocyclohex-1-en-1-yl)acrylic acid (CAS: 899809-64-4)?

This compound is primarily used in the pharmaceutical industry for the synthesis of certain drug int...

Compound Q&A

What precautions should be taken when handling (E)-3-(5-Nitrocyclohex-1-en-1-yl)acrylic acid (CAS: 899809-64-4)?

When handling (E)-3-(5-Nitrocyclohex-1-en-1-yl)acrylic acid, appropriate personal protective equipme...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...