Compound Q&A

How is (E)-3-(5-Nitrocyclohex-1-en-1-yl)acrylic acid (CAS: 899809-64-4) typically synthesized?

Answer

(E)-3-(5-Nitrocyclohex-1-en-1-yl)acrylic acid
This compound can be synthesized via the nitration of (E)-3-(cyclohex-1-en-1-yl)acrylic acid followed by dehydration. Commonly, nitric acid and sulfuric acid are used as the nitrating mixture under controlled conditions. The yield is generally around 70-80%, and the product is purified by recrystallization.

About

English Name (E)-3-(5-Nitrocyclohex-1-en-1-yl)acrylic acid
Molecular Formula C9H11NO4
Molecular Weight 197.19 g/mol
SMILES C1CC(CC(=C1)C=CC(=O)O)[N+](=O)[O-]
InChIKey PEYXGOWSKLZBEO-SNAWJCMRSA-N
Last Updated: 2025-10-13 12:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of (E)-3-(5-Nitrocyclohex-1-en-1-yl)acrylic acid (CAS: 899809-64-4)?

(E)-3-(5-Nitrocyclohex-1-en-1-yl)acrylic acid is a white crystalline solid with a molecular weight o...

Compound Q&A

What industries use (E)-3-(5-Nitrocyclohex-1-en-1-yl)acrylic acid (CAS: 899809-64-4)?

This compound is primarily used in the pharmaceutical industry for the synthesis of certain drug int...

Compound Q&A

What precautions should be taken when handling (E)-3-(5-Nitrocyclohex-1-en-1-yl)acrylic acid (CAS: 899809-64-4)?

When handling (E)-3-(5-Nitrocyclohex-1-en-1-yl)acrylic acid, appropriate personal protective equipme...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...