Compound Q&A

What industries use (5S)-5-Ethyl-3-methyl-5-phenyl-2,4-imidazolidinedione (CAS: 70989-04-7)?

Answer

(5S)-5-Ethyl-3-methyl-5-phenyl-2,4-imidazolidinedione
The compound (5S)-5-Ethyl-3-methyl-5-phenyl-2,4-imidazolidinedione is used in various industries. It is a key intermediate in the synthesis of pharmaceuticals, particularly in the production of anti-inflammatory drugs. Additionally, it has applications in the production of polymers and sensors. Its ability to form stable metal complexes makes it useful in semiconductor industry for manufacturing solar cells and other electronic devices.

About

CAS No 70989-04-7
English Name (5S)-5-Ethyl-3-methyl-5-phenyl-2,4-imidazolidinedione
Molecular Formula C12H14N2O2
Molecular Weight 218.26 g/mol
SMILES CCC1(C(=O)N(C(=O)N1)C)C2=CC=CC=C2
InChIKey GMHKMTDVRCWUDX-LBPRGKRZSA-N
Last Updated: 2025-10-13 12:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of (5S)-5-Ethyl-3-methyl-5-phenyl-2,4-imidazolidinedione (CAS: 70989-04-7)?

The compound (5S)-5-Ethyl-3-methyl-5-phenyl-2,4-imidazolidinedione is a white crystalline solid with...

Compound Q&A

How is (5S)-5-Ethyl-3-methyl-5-phenyl-2,4-imidazolidinedione (CAS: 70989-04-7) typically synthesized?

The compound (5S)-5-Ethyl-3-methyl-5-phenyl-2,4-imidazolidinedione is typically synthesized through ...

Compound Q&A

What precautions should be taken when handling (5S)-5-Ethyl-3-methyl-5-phenyl-2,4-imidazolidinedione (CAS: 70989-04-7)?

When handling (5S)-5-Ethyl-3-methyl-5-phenyl-2,4-imidazolidinedione, it is essential to use personal...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...