Compound Q&A

What are the physical and chemical properties of (5S)-5-Ethyl-3-methyl-5-phenyl-2,4-imidazolidinedione (CAS: 70989-04-7)?

Answer

(5S)-5-Ethyl-3-methyl-5-phenyl-2,4-imidazolidinedione
The compound (5S)-5-Ethyl-3-methyl-5-phenyl-2,4-imidazolidinedione is a white crystalline solid with a molecular weight of approximately 256.27 g/mol. It is slightly soluble in water and soluble in organic solvents like ethanol and acetone. The compound exhibits good thermal stability up to 150°C. It is known for its reactivity in nucleophilic substitution reactions and its ability to form complexes with various metal ions.

About

CAS No 70989-04-7
English Name (5S)-5-Ethyl-3-methyl-5-phenyl-2,4-imidazolidinedione
Molecular Formula C12H14N2O2
Molecular Weight 218.26 g/mol
SMILES CCC1(C(=O)N(C(=O)N1)C)C2=CC=CC=C2
InChIKey GMHKMTDVRCWUDX-LBPRGKRZSA-N
Last Updated: 2025-10-13 12:55

Related Q&A

Compound Q&A

How is (5S)-5-Ethyl-3-methyl-5-phenyl-2,4-imidazolidinedione (CAS: 70989-04-7) typically synthesized?

The compound (5S)-5-Ethyl-3-methyl-5-phenyl-2,4-imidazolidinedione is typically synthesized through ...

Compound Q&A

What industries use (5S)-5-Ethyl-3-methyl-5-phenyl-2,4-imidazolidinedione (CAS: 70989-04-7)?

The compound (5S)-5-Ethyl-3-methyl-5-phenyl-2,4-imidazolidinedione is used in various industries. It...

Compound Q&A

What precautions should be taken when handling (5S)-5-Ethyl-3-methyl-5-phenyl-2,4-imidazolidinedione (CAS: 70989-04-7)?

When handling (5S)-5-Ethyl-3-methyl-5-phenyl-2,4-imidazolidinedione, it is essential to use personal...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...