Compound Q&A

What are the physical and chemical properties of (1R,2S)-1-Phenyl-2-(1-pyrrolidinyl)-1-propanol (CAS: 127641-25-2)?

Answer

(1R,2S)-1-Phenyl-2-(1-pyrrolidinyl)-1-propanol
(1R,2S)-1-Phenyl-2-(1-pyrrolidinyl)-1-propanol is a clear, colorless liquid with a molecular weight of approximately 211.27 g/mol. It has a pKa of approximately 11.6. The compound is soluble in organic solvents such as ethanol and acetone, but less soluble in water. It is reactive towards strong acids and bases, and it can undergo substitution reactions.

About

English Name (1R,2S)-1-Phenyl-2-(1-pyrrolidinyl)-1-propanol
Molecular Formula C13H19NO
Molecular Weight 205.3 g/mol
SMILES C[C@@H]([C@H](O)c1ccccc1)N2CCCC2
InChIKey FZVHJGJBJLFWEX-AAEUAGOBSA-N
Last Updated: 2025-10-13 12:55

Related Q&A

Compound Q&A

How is (1R,2S)-1-Phenyl-2-(1-pyrrolidinyl)-1-propanol (CAS: 127641-25-2) typically synthesized?

(1R,2S)-1-Phenyl-2-(1-pyrrolidinyl)-1-propanol is typically synthesized by the reaction of (1R,2S)-1...

Compound Q&A

What industries use (1R,2S)-1-Phenyl-2-(1-pyrrolidinyl)-1-propanol (CAS: 127641-25-2)?

(1R,2S)-1-Phenyl-2-(1-pyrrolidinyl)-1-propanol is mainly used in the pharmaceutical industry as an i...

Compound Q&A

What precautions should be taken when handling (1R,2S)-1-Phenyl-2-(1-pyrrolidinyl)-1-propanol (CAS: 127641-25-2)?

When handling (1R,2S)-1-Phenyl-2-(1-pyrrolidinyl)-1-propanol, it is important to use personal protec...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...