Compound Q&A

What industries use N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-L-alanyl-L-alanine (CAS: 87512-31-0)?

Answer

N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-L-alanyl-L-alanine
N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-L-alanyl-L-alanine (CAS: 87512-31-0) is primarily used in the pharmaceutical industry for the synthesis of peptides and as a building block in medicinal chemistry. It also finds applications in polymer science for the synthesis of functional polymers and in sensor technology for its stability and reactivity.

About

CAS No 87512-31-0
English Name N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-L-alanyl-L-alanine
Molecular Formula C21H22N2O5
Molecular Weight 382.42 g/mol
SMILES C[C@H](NC(=O)[C@H](C)NC(=O)OCC1c2ccccc2-c3ccccc13)C(=O)O
InChIKey VXGGBPQPMISJCA-STQMWFEESA-N
Last Updated: 2025-10-13 12:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-L-alanyl-L-alanine (CAS: 87512-31-0)?

N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-L-alanyl-L-alanine (CAS: 87512-31-0) is a crystalline compound....

Compound Q&A

How is N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-L-alanyl-L-alanine (CAS: 87512-31-0) typically synthesized?

N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-L-alanyl-L-alanine (CAS: 87512-31-0) is synthesized through a m...

Compound Q&A

What precautions should be taken when handling N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-L-alanyl-L-alanine (CAS: 87512-31-0)?

When handling N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-L-alanyl-L-alanine (CAS: 87512-31-0), it is impor...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...