Compound Q&A

What are the physical and chemical properties of N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-L-alanyl-L-alanine (CAS: 87512-31-0)?

Answer

N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-L-alanyl-L-alanine
N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-L-alanyl-L-alanine (CAS: 87512-31-0) is a crystalline compound. Its molecular weight is approximately 432.44 g/mol. It has moderate solubility in common organic solvents like methanol and chloroform. This compound is known for its stability and reactivity in organic reactions. It can undergo peptide bond formation and other amide reactions with good selectivity.

About

CAS No 87512-31-0
English Name N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-L-alanyl-L-alanine
Molecular Formula C21H22N2O5
Molecular Weight 382.42 g/mol
SMILES C[C@H](NC(=O)[C@H](C)NC(=O)OCC1c2ccccc2-c3ccccc13)C(=O)O
InChIKey VXGGBPQPMISJCA-STQMWFEESA-N
Last Updated: 2025-10-13 12:55

Related Q&A

Compound Q&A

How is N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-L-alanyl-L-alanine (CAS: 87512-31-0) typically synthesized?

N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-L-alanyl-L-alanine (CAS: 87512-31-0) is synthesized through a m...

Compound Q&A

What industries use N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-L-alanyl-L-alanine (CAS: 87512-31-0)?

N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-L-alanyl-L-alanine (CAS: 87512-31-0) is primarily used in the p...

Compound Q&A

What precautions should be taken when handling N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-L-alanyl-L-alanine (CAS: 87512-31-0)?

When handling N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-L-alanyl-L-alanine (CAS: 87512-31-0), it is impor...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...