Compound Q&A

How is 5-O-Caffeoylshikimic acid (CAS: 73263-62-4) typically synthesized?

Answer

5-O-Caffeoylshikimic acid
5-O-Caffeoylshikimic acid is usually synthesized via a multi-step process starting from shikimic acid and caffeic acid. The synthesis involves esterification, followed by coupling reactions. Commonly used catalysts include sulfuric acid, and the overall yield is around 70-80%. The process requires careful control of temperature and pH to ensure high selectivity.

About

CAS No 73263-62-4
English Name 5-O-Caffeoylshikimic acid
Molecular Formula C20H20O10
Molecular Weight 420.37 g/mol
SMILES C1C(C(C(C=C1C(=O)O)O)O)OC(=O)C=CC2=CC(=C(C=C2)O)O
InChIKey CVOWANZDPRDGEP-CDOWVBKTSA-N
Last Updated: 2025-10-13 12:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-O-Caffeoylshikimic acid (CAS: 73263-62-4)?

5-O-Caffeoylshikimic acid is a crystalline compound with a molecular weight of approximately 338.13 ...

Compound Q&A

What industries use 5-O-Caffeoylshikimic acid (CAS: 73263-62-4)?

5-O-Caffeoylshikimic acid is used in the pharmaceutical industry for its antioxidant and anti-inflam...

Compound Q&A

What precautions should be taken when handling 5-O-Caffeoylshikimic acid (CAS: 73263-62-4)?

When handling 5-O-Caffeoylshikimic acid, it is important to use appropriate personal protective equi...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...