Compound Q&A

What are the physical and chemical properties of 5-O-Caffeoylshikimic acid (CAS: 73263-62-4)?

Answer

5-O-Caffeoylshikimic acid
5-O-Caffeoylshikimic acid is a crystalline compound with a molecular weight of approximately 338.13 g/mol. It is slightly soluble in water and ethanol. Chemically, it is less reactive than many other phenolic compounds due to its conjugated structure. It is stable under normal conditions but can degrade when exposed to strong acids or bases.

About

CAS No 73263-62-4
English Name 5-O-Caffeoylshikimic acid
Molecular Formula C20H20O10
Molecular Weight 420.37 g/mol
SMILES C1C(C(C(C=C1C(=O)O)O)O)OC(=O)C=CC2=CC(=C(C=C2)O)O
InChIKey CVOWANZDPRDGEP-CDOWVBKTSA-N
Last Updated: 2025-10-13 12:55

Related Q&A

Compound Q&A

How is 5-O-Caffeoylshikimic acid (CAS: 73263-62-4) typically synthesized?

5-O-Caffeoylshikimic acid is usually synthesized via a multi-step process starting from shikimic aci...

Compound Q&A

What industries use 5-O-Caffeoylshikimic acid (CAS: 73263-62-4)?

5-O-Caffeoylshikimic acid is used in the pharmaceutical industry for its antioxidant and anti-inflam...

Compound Q&A

What precautions should be taken when handling 5-O-Caffeoylshikimic acid (CAS: 73263-62-4)?

When handling 5-O-Caffeoylshikimic acid, it is important to use appropriate personal protective equi...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...