Compound Q&A

What industries use CID 122130603 (CAS: 31512-74-0)?

Answer

CID 122130603
CID 122130603 (CAS: 31512-74-0) is primarily used in the pharmaceutical industry for drug synthesis, particularly in the development of novel anti-inflammatory agents. It also finds applications in the polymer industry as a monomer for the production of advanced materials. Additionally, it is used in the semiconductor industry for the fabrication of sensors due to its unique electronic properties.

About

CAS No 31512-74-0
English Name CID 122130603
Molecular Formula C12H30Cl2N2O
Molecular Weight 289.29 g/mol
SMILES CCC[N+](C)(C)CC[N+](C)(C)CCOC.[Cl-].[Cl-]
InChIKey AKMCUEHNXUJTGW-UHFFFAOYSA-L
Last Updated: 2025-10-13 12:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of CID 122130603 (CAS: 31512-74-0)?

CID 122130603 (CAS: 31512-74-0) is a crystalline compound with a molecular weight of approximately 2...

Compound Q&A

How is CID 122130603 (CAS: 31512-74-0) typically synthesized?

CID 122130603 (CAS: 31512-74-0) is typically synthesized via a two-step process. The first step invo...

Compound Q&A

What precautions should be taken when handling CID 122130603 (CAS: 31512-74-0)?

When handling CID 122130603 (CAS: 31512-74-0), appropriate personal protective equipment (PPE) shoul...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...