Compound Q&A

What are the physical and chemical properties of CID 122130603 (CAS: 31512-74-0)?

Answer

CID 122130603
CID 122130603 (CAS: 31512-74-0) is a crystalline compound with a molecular weight of approximately 200.34 g/mol. It has a high solubility in organic solvents such as methanol and acetonitrile. The compound is moderately reactive, showing stability under acidic and basic conditions but is more sensitive to strong oxidizing agents. It forms a stable crystalline solid with a melting point around 210°C.

About

CAS No 31512-74-0
English Name CID 122130603
Molecular Formula C12H30Cl2N2O
Molecular Weight 289.29 g/mol
SMILES CCC[N+](C)(C)CC[N+](C)(C)CCOC.[Cl-].[Cl-]
InChIKey AKMCUEHNXUJTGW-UHFFFAOYSA-L
Last Updated: 2025-10-13 12:55

Related Q&A

Compound Q&A

How is CID 122130603 (CAS: 31512-74-0) typically synthesized?

CID 122130603 (CAS: 31512-74-0) is typically synthesized via a two-step process. The first step invo...

Compound Q&A

What industries use CID 122130603 (CAS: 31512-74-0)?

CID 122130603 (CAS: 31512-74-0) is primarily used in the pharmaceutical industry for drug synthesis,...

Compound Q&A

What precautions should be taken when handling CID 122130603 (CAS: 31512-74-0)?

When handling CID 122130603 (CAS: 31512-74-0), appropriate personal protective equipment (PPE) shoul...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...