Compound Q&A

What are the physical and chemical properties of 1-Bromo-4-cyclohexylbenzene (CAS: 25109-28-8)?

Answer

1-Bromo-4-cyclohexylbenzene
1-Bromo-4-cyclohexylbenzene (CAS: 25109-28-8) is a solid crystalline compound with a molecular weight of approximately 215.12 g/mol. It has a low solubility in water but is soluble in common organic solvents like ethanol and dichloromethane. Chemically, it is reactive towards nucleophiles and electrophiles. It is a brominated derivative of benzene with a cyclohexyl substituent, making it useful in organic synthesis and as a precursor for various functionalized compounds.

About

CAS No 25109-28-8
English Name 1-Bromo-4-cyclohexylbenzene
Molecular Formula C12H15Br
Molecular Weight 239.16 g/mol
SMILES C1CCC(CC1)C2=CC=C(C=C2)Br
InChIKey LVIJLEREXMVRAN-UHFFFAOYSA-N
Last Updated: 2025-10-13 11:18

Related Q&A

Compound Q&A

How is 1-Bromo-4-cyclohexylbenzene (CAS: 25109-28-8) typically synthesized?

1-Bromo-4-cyclohexylbenzene (CAS: 25109-28-8) is typically synthesized via a substitution reaction. ...

Compound Q&A

What industries use 1-Bromo-4-cyclohexylbenzene (CAS: 25109-28-8)?

1-Bromo-4-cyclohexylbenzene (CAS: 25109-28-8) is primarily used in organic synthesis as a precursor ...

Compound Q&A

What precautions should be taken when handling 1-Bromo-4-cyclohexylbenzene (CAS: 25109-28-8)?

When handling 1-Bromo-4-cyclohexylbenzene (CAS: 25109-28-8), it is essential to wear appropriate per...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...