Compound Q&A

What precautions should be taken when handling 2-Methyl-4-[(2-methylbenzoyl)amino]benzoic acid (CAS: 317374-08-6)?

Answer

2-Methyl-4-[(2-methylbenzoyl)amino]benzoic acid
When handling 2-Methyl-4-[(2-methylbenzoyl)amino]benzoic acid (CAS: 317374-08-6), it is essential to wear protective equipment such as gloves and safety goggles. It should be stored in a cool, dry place away from strong bases and acids to avoid degradation. Ensure adequate ventilation and use a fume hood during handling and synthesis. Always refer to the Safety Data Sheet (SDS) for detailed safety information and emergency procedures.

About

English Name 2-Methyl-4-[(2-methylbenzoyl)amino]benzoic acid
Molecular Formula C16H15NO3
Molecular Weight 269.3 g/mol
SMILES CC1=CC=CC=C1C(=O)NC2=CC(=C(C=C2)C(=O)O)C
InChIKey KJGSVQLCVULXJU-UHFFFAOYSA-N
Last Updated: 2025-10-13 11:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methyl-4-[(2-methylbenzoyl)amino]benzoic acid (CAS: 317374-08-6)?

The compound 2-Methyl-4-[(2-methylbenzoyl)amino]benzoic acid (CAS: 317374-08-6) is a white to off-wh...

Compound Q&A

How is 2-Methyl-4-[(2-methylbenzoyl)amino]benzoic acid (CAS: 317374-08-6) typically synthesized?

2-Methyl-4-[(2-methylbenzoyl)amino]benzoic acid (CAS: 317374-08-6) is typically synthesized via a mu...

Compound Q&A

What industries use 2-Methyl-4-[(2-methylbenzoyl)amino]benzoic acid (CAS: 317374-08-6)?

2-Methyl-4-[(2-methylbenzoyl)amino]benzoic acid (CAS: 317374-08-6) is used in various industries, pr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...