Compound Q&A

What are the physical and chemical properties of 2-Methyl-4-[(2-methylbenzoyl)amino]benzoic acid (CAS: 317374-08-6)?

Answer

2-Methyl-4-[(2-methylbenzoyl)amino]benzoic acid
The compound 2-Methyl-4-[(2-methylbenzoyl)amino]benzoic acid (CAS: 317374-08-6) is a white to off-white crystalline solid with a molecular weight of approximately 302.29 g/mol. It has a low solubility in water but is more soluble in organic solvents like ethanol and methanol. The compound is relatively stable under normal conditions but can react with strong bases. It is an important intermediate in organic synthesis and pharmaceuticals.

About

English Name 2-Methyl-4-[(2-methylbenzoyl)amino]benzoic acid
Molecular Formula C16H15NO3
Molecular Weight 269.3 g/mol
SMILES CC1=CC=CC=C1C(=O)NC2=CC(=C(C=C2)C(=O)O)C
InChIKey KJGSVQLCVULXJU-UHFFFAOYSA-N
Last Updated: 2025-10-13 11:18

Related Q&A

Compound Q&A

How is 2-Methyl-4-[(2-methylbenzoyl)amino]benzoic acid (CAS: 317374-08-6) typically synthesized?

2-Methyl-4-[(2-methylbenzoyl)amino]benzoic acid (CAS: 317374-08-6) is typically synthesized via a mu...

Compound Q&A

What industries use 2-Methyl-4-[(2-methylbenzoyl)amino]benzoic acid (CAS: 317374-08-6)?

2-Methyl-4-[(2-methylbenzoyl)amino]benzoic acid (CAS: 317374-08-6) is used in various industries, pr...

Compound Q&A

What precautions should be taken when handling 2-Methyl-4-[(2-methylbenzoyl)amino]benzoic acid (CAS: 317374-08-6)?

When handling 2-Methyl-4-[(2-methylbenzoyl)amino]benzoic acid (CAS: 317374-08-6), it is essential to...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...