Compound Q&A

What industries use (2R)-2-Amino-4-pentynoic acid hydrochloride (CAS: 87205-47-8)?

Answer

(2R)-2-Amino-4-pentynoic acid hydrochloride (1:1)
(2R)-2-Amino-4-pentynoic acid hydrochloride is used in the pharmaceutical industry for the synthesis of certain biologically active compounds. It is also utilized in the polymer industry for the modification of polymer chains and in the development of novel materials. Additionally, it can be applied in the semiconductor industry for the production of sensors and in the formulation of some electronic devices.

About

CAS No 87205-47-8
English Name (2R)-2-Amino-4-pentynoic acid hydrochloride (1:1)
Molecular Formula C5H8ClNO2
Molecular Weight 16.04 g/mol
SMILES C#CC[C@@H](N)C(O)=O.[H]Cl
InChIKey UAMBUICGODABQY-PGMHMLKASA-N
Last Updated: 2025-10-13 11:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2R)-2-Amino-4-pentynoic acid hydrochloride (CAS: 87205-47-8)?

(2R)-2-Amino-4-pentynoic acid hydrochloride is a white crystalline solid with a molecular weight of ...

Compound Q&A

How is (2R)-2-Amino-4-pentynoic acid hydrochloride (CAS: 87205-47-8) typically synthesized?

(2R)-2-Amino-4-pentynoic acid hydrochloride is typically synthesized by reacting 2-amino-4-pentynoic...

Compound Q&A

What precautions should be taken when handling (2R)-2-Amino-4-pentynoic acid hydrochloride (CAS: 87205-47-8)?

When handling (2R)-2-Amino-4-pentynoic acid hydrochloride, appropriate personal protective equipment...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...